C8H12N2O2 — CID 58295023
3,6-diethyl-1H-pyrimidine-2,4-dione (PubChem CID 58295023) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 3,6-diethyl-1H-pyrimidine-2,4-dione.
| Compound Name | 3,6-diethyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58295023 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 3,6-diethyl-1H-pyrimidine-2,4-dione |
| SMILES | CCc1cc(=O)n(CC)c(=O)[nH]1 |
| InChI | InChI=1S/C8H12N2O2/c1-3-6-5-7(11)10(4-2)8(12)9-6/h5H,3-4H2,1-2H3,(H,9,12) |
| InChIKey | OIJWPWQYUQDHNJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |