About 4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one
4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one (PubChem CID 58295741) has the molecular formula C21H18BrF3N2O2
and a molecular weight of 467.29 g/mol. Its IUPAC name is 4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one.
Molecular Properties
| Compound Name | 4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one |
| PubChem CID | 58295741 |
| Molecular Formula | C21H18BrF3N2O2 |
| Molecular Weight | 467.29 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one |
| SMILES | O=C1NC2(CCN(C(=O)Cc3ccccc3C(F)(F)F)CC2)c2c(Br)cccc21 |
| InChI | InChI=1S/C21H18BrF3N2O2/c22-16-7-3-5-14-18(16)20(26-19(14)29)8-10-27(11-9-20)17(28)12-13-4-1-2-6-15(13)21(23,24)25/h1-7H,8-12H2,(H,26,29) |
| InChIKey | QQZIAKKFZNTSMF-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.29 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one?
The IUPAC name of 4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one (CID 58295741) is 4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one.
What is the SMILES notation for 4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one?
The canonical SMILES for 4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one is O=C1NC2(CCN(C(=O)Cc3ccccc3C(F)(F)F)CC2)c2c(Br)cccc21.
What is the InChIKey of 4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one?
The InChIKey is QQZIAKKFZNTSMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18BrF3N2O2/c22-16-7-3-5-14-18(16)20(26-19(14)29)8-10-27(11-9-20)17(28)12-13-4-1-2-6-15(13)21(23,24)25/h1-7H,8-12H2,(H,26,29).
What are the key properties of 4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one?
4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one has a molecular weight of 467.29 g/mol, XLogP of 4.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1'-[2-[2-(trifluoromethyl)phenyl]acetyl]spiro[2H-isoindole-3,4'-piperidine]-1-one is sourced from PubChem (CID 58295741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).