C11H12F2N6 — CID 58296073
3,5-difluoro-4-[3-(tetrazol-2-yl)pyrrolidin-1-yl]aniline (PubChem CID 58296073) has the molecular formula C11H12F2N6 and a molecular weight of 266.25 g/mol. Its IUPAC name is 3,5-difluoro-4-[3-(tetrazol-2-yl)pyrrolidin-1-yl]aniline.
| Compound Name | 3,5-difluoro-4-[3-(tetrazol-2-yl)pyrrolidin-1-yl]aniline |
|---|---|
| PubChem CID | 58296073 |
| Molecular Formula | C11H12F2N6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3,5-difluoro-4-[3-(tetrazol-2-yl)pyrrolidin-1-yl]aniline |
| SMILES | Nc1cc(F)c(N2CCC(n3ncnn3)C2)c(F)c1 |
| InChI | InChI=1S/C11H12F2N6/c12-9-3-7(14)4-10(13)11(9)18-2-1-8(5-18)19-16-6-15-17-19/h3-4,6,8H,1-2,5,14H2 |
| InChIKey | PUQBCACKATZDEN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|