C25H32N4O3 — CID 58296388
methyl 2-[4-[4-(6-methoxy-1-methylindol-3-yl)butyl]piperidin-1-yl]pyrimidine-5-carboxylate (PubChem CID 58296388) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is methyl 2-[4-[4-(6-methoxy-1-methylindol-3-yl)butyl]piperidin-1-yl]pyrimidine-5-carboxylate.
| Compound Name | methyl 2-[4-[4-(6-methoxy-1-methylindol-3-yl)butyl]piperidin-1-yl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 58296388 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | methyl 2-[4-[4-(6-methoxy-1-methylindol-3-yl)butyl]piperidin-1-yl]pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1cnc(N2CCC(CCCCc3cn(C)c4cc(OC)ccc34)CC2)nc1 |
| InChI | InChI=1S/C25H32N4O3/c1-28-17-19(22-9-8-21(31-2)14-23(22)28)7-5-4-6-18-10-12-29(13-11-18)25-26-15-20(16-27-25)24(30)32-3/h8-9,14-18H,4-7,10-13H2,1-3H3 |
| InChIKey | NPRKPBVOOYLICB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|