C27H34FN5O3 — CID 58296405
2-[4-[3-(4-fluoro-1-methylindol-3-yl)propyl]piperidin-1-yl]-N-(oxan-2-yloxy)pyrimidine-5-carboxamide (PubChem CID 58296405) has the molecular formula C27H34FN5O3 and a molecular weight of 495.60 g/mol. Its IUPAC name is 2-[4-[3-(4-fluoro-1-methylindol-3-yl)propyl]piperidin-1-yl]-N-(oxan-2-yloxy)pyrimidine-5-carboxamide.
| Compound Name | 2-[4-[3-(4-fluoro-1-methylindol-3-yl)propyl]piperidin-1-yl]-N-(oxan-2-yloxy)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 58296405 |
| Molecular Formula | C27H34FN5O3 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 2-[4-[3-(4-fluoro-1-methylindol-3-yl)propyl]piperidin-1-yl]-N-(oxan-2-yloxy)pyrimidine-5-carboxamide |
| SMILES | Cn1cc(CCCC2CCN(c3ncc(C(=O)NOC4CCCCO4)cn3)CC2)c2c(F)cccc21 |
| InChI | InChI=1S/C27H34FN5O3/c1-32-18-20(25-22(28)8-5-9-23(25)32)7-4-6-19-11-13-33(14-12-19)27-29-16-21(17-30-27)26(34)31-36-24-10-2-3-15-35-24/h5,8-9,16-19,24H,2-4,6-7,10-15H2,1H3,(H,31,34) |
| InChIKey | RNOMJQSCOLQOHB-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|