C20H19N3O4S — CID 58298578
1-[(2R)-2-amino-1,2-diphenylethyl]sulfinamoyloxy-4-nitrobenzene (PubChem CID 58298578) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is 1-[(2R)-2-amino-1,2-diphenylethyl]sulfinamoyloxy-4-nitrobenzene.
| Compound Name | 1-[(2R)-2-amino-1,2-diphenylethyl]sulfinamoyloxy-4-nitrobenzene |
|---|---|
| PubChem CID | 58298578 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1-[(2R)-2-amino-1,2-diphenylethyl]sulfinamoyloxy-4-nitrobenzene |
| SMILES | N[C@H](c1ccccc1)C(NS(=O)Oc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C20H19N3O4S/c21-19(15-7-3-1-4-8-15)20(16-9-5-2-6-10-16)22-28(26)27-18-13-11-17(12-14-18)23(24)25/h1-14,19-20,22H,21H2/t19-,20?,28?/m1/s1 |
| InChIKey | KFNCMJYFPONACP-XECQOBAQSA-N |
| XLogP | 3.58 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|