C17H24N2O — CID 58298824
2-(3,3-dimethyl-2-methylideneindol-1-yl)-N,N-diethylacetamide (PubChem CID 58298824) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-(3,3-dimethyl-2-methylideneindol-1-yl)-N,N-diethylacetamide.
| Compound Name | 2-(3,3-dimethyl-2-methylideneindol-1-yl)-N,N-diethylacetamide |
|---|---|
| PubChem CID | 58298824 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-(3,3-dimethyl-2-methylideneindol-1-yl)-N,N-diethylacetamide |
| SMILES | C=C1N(CC(=O)N(CC)CC)c2ccccc2C1(C)C |
| InChI | InChI=1S/C17H24N2O/c1-6-18(7-2)16(20)12-19-13(3)17(4,5)14-10-8-9-11-15(14)19/h8-11H,3,6-7,12H2,1-2,4-5H3 |
| InChIKey | MMMJNEBHKYMEFQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |