C30H41N7O2Si — CID 58299613
5-[[5-[(3R)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-2-pyridinyl]amino]-8-cyclopentyl-10-methyl-4,6,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,12-pentaen-11-one (PubChem CID 58299613) has the molecular formula C30H41N7O2Si and a molecular weight of 559.79 g/mol. Its IUPAC name is 5-[[5-[(3R)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-2-pyridinyl]amino]-8-cyclopentyl-10-methyl-4,6,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,12-pentaen-11-one.
| Compound Name | 5-[[5-[(3R)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-2-pyridinyl]amino]-8-cyclopentyl-10-methyl-4,6,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,12-pentaen-11-one |
|---|---|
| PubChem CID | 58299613 |
| Molecular Formula | C30H41N7O2Si |
| Molecular Weight | 559.79 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | 5-[[5-[(3R)-3-[tert-butyl(dimethyl)silyl]oxypyrrolidin-1-yl]-2-pyridinyl]amino]-8-cyclopentyl-10-methyl-4,6,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,12-pentaen-11-one |
| SMILES | Cn1c(=O)ccc2c3cnc(Nc4ccc(N5CC[C@@H](O[Si](C)(C)C(C)(C)C)C5)cn4)nc3n(C3CCCC3)c21 |
| InChI | InChI=1S/C30H41N7O2Si/c1-30(2,3)40(5,6)39-22-15-16-36(19-22)21-11-13-25(31-17-21)33-29-32-18-24-23-12-14-26(38)35(4)28(23)37(27(24)34-29)20-9-7-8-10-20/h11-14,17-18,20,22H,7-10,15-16,19H2,1-6H3,(H,31,32,33,34)/t22-/m1/s1 |
| InChIKey | YGAJERHOBSELEK-JOCHJYFZSA-N |
| XLogP | 6.14 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.79 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|