About ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate
ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate (PubChem CID 58304750) has the molecular formula C16H21O3P
and a molecular weight of 292.31 g/mol. Its IUPAC name is ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate.
Molecular Properties
| Compound Name | ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate |
| PubChem CID | 58304750 |
| Molecular Formula | C16H21O3P |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate |
| SMILES | CCOC(=O)c1c(C)cc(C#CCCPOC)cc1C |
| InChI | InChI=1S/C16H21O3P/c1-5-19-16(17)15-12(2)10-14(11-13(15)3)8-6-7-9-20-18-4/h10-11,20H,5,7,9H2,1-4H3 |
| InChIKey | HAGXYKSVWCYFFN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate?
The IUPAC name of ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate (CID 58304750) is ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate.
What is the SMILES notation for ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate?
The canonical SMILES for ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate is CCOC(=O)c1c(C)cc(C#CCCPOC)cc1C.
What is the InChIKey of ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate?
The InChIKey is HAGXYKSVWCYFFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21O3P/c1-5-19-16(17)15-12(2)10-14(11-13(15)3)8-6-7-9-20-18-4/h10-11,20H,5,7,9H2,1-4H3.
What are the key properties of ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate?
ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate has a molecular weight of 292.31 g/mol, XLogP of 3.46, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate is sourced from PubChem (CID 58304750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).