C32H46O6P2 — CID 161203197
ethyl 4-(4-methoxyphosphanylbutyl)-2,6-dimethylbenzoate;ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate (PubChem CID 161203197) has the molecular formula C32H46O6P2 and a molecular weight of 588.66 g/mol. Its IUPAC name is ethyl 4-(4-methoxyphosphanylbutyl)-2,6-dimethylbenzoate;ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate.
| Compound Name | ethyl 4-(4-methoxyphosphanylbutyl)-2,6-dimethylbenzoate;ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate |
|---|---|
| PubChem CID | 161203197 |
| Molecular Formula | C32H46O6P2 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | ethyl 4-(4-methoxyphosphanylbutyl)-2,6-dimethylbenzoate;ethyl 4-(4-methoxyphosphanylbut-1-ynyl)-2,6-dimethylbenzoate |
| SMILES | CCOC(=O)c1c(C)cc(C#CCCPOC)cc1C.CCOC(=O)c1c(C)cc(CCCCPOC)cc1C |
| InChI | InChI=1S/C16H25O3P.C16H21O3P/c2*1-5-19-16(17)15-12(2)10-14(11-13(15)3)8-6-7-9-20-18-4/h10-11,20H,5-9H2,1-4H3;10-11,20H,5,7,9H2,1-4H3 |
| InChIKey | UVGIHKUBJMMXBR-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|