C18H15BrClNO — CID 58305388
(1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one (PubChem CID 58305388) has the molecular formula C18H15BrClNO and a molecular weight of 376.68 g/mol. Its IUPAC name is (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one.
| Compound Name | (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 58305388 |
| Molecular Formula | C18H15BrClNO |
| Molecular Weight | 376.68 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one |
| SMILES | O=C1N(CCBr)c2ccccc2[C@@]12C[C@@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15BrClNO/c19-9-10-21-16-4-2-1-3-14(16)18(17(21)22)11-15(18)12-5-7-13(20)8-6-12/h1-8,15H,9-11H2/t15-,18-/m1/s1 |
| InChIKey | MRHXMCBJRWBXBJ-CRAIPNDOSA-N |
| XLogP | 4.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.68 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|