About (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one
(1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one (PubChem CID 58305388) has the molecular formula C18H15BrClNO
and a molecular weight of 376.68 g/mol. Its IUPAC name is (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one.
Molecular Properties
| Compound Name | (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one |
| PubChem CID | 58305388 |
| Molecular Formula | C18H15BrClNO |
| Molecular Weight | 376.68 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one |
| SMILES | O=C1N(CCBr)c2ccccc2[C@@]12C[C@@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15BrClNO/c19-9-10-21-16-4-2-1-3-14(16)18(17(21)22)11-15(18)12-5-7-13(20)8-6-12/h1-8,15H,9-11H2/t15-,18-/m1/s1 |
| InChIKey | MRHXMCBJRWBXBJ-CRAIPNDOSA-N |
| XLogP | 4.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.68 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one?
The IUPAC name of (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one (CID 58305388) is (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one.
What is the SMILES notation for (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one?
The canonical SMILES for (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one is O=C1N(CCBr)c2ccccc2[C@@]12C[C@@H]2c1ccc(Cl)cc1.
What is the InChIKey of (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one?
The InChIKey is MRHXMCBJRWBXBJ-CRAIPNDOSA-N. The full InChI is InChI=1S/C18H15BrClNO/c19-9-10-21-16-4-2-1-3-14(16)18(17(21)22)11-15(18)12-5-7-13(20)8-6-12/h1-8,15H,9-11H2/t15-,18-/m1/s1.
What are the key properties of (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one?
(1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one has a molecular weight of 376.68 g/mol, XLogP of 4.51, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-1'-(2-bromoethyl)-2-(4-chlorophenyl)spiro[cyclopropane-1,3'-indole]-2'-one is sourced from PubChem (CID 58305388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).