C27H45N7O5Si2 — CID 58308013
1-[6-amino-9-[(3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-ethyloxolan-2-yl]purin-2-yl]pyrazole-4-carboxylic acid (PubChem CID 58308013) has the molecular formula C27H45N7O5Si2 and a molecular weight of 603.87 g/mol. Its IUPAC name is 1-[6-amino-9-[(3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-ethyloxolan-2-yl]purin-2-yl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[6-amino-9-[(3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-ethyloxolan-2-yl]purin-2-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 58308013 |
| Molecular Formula | C27H45N7O5Si2 |
| Molecular Weight | 603.87 g/mol |
| Exact Mass | 603.30 |
| IUPAC Name | 1-[6-amino-9-[(3R,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-ethyloxolan-2-yl]purin-2-yl]pyrazole-4-carboxylic acid |
| SMILES | CC[C@H]1OC(n2cnc3c(N)nc(-n4cc(C(=O)O)cn4)nc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H45N7O5Si2/c1-12-17-19(38-40(8,9)26(2,3)4)20(39-41(10,11)27(5,6)7)23(37-17)33-15-29-18-21(28)31-25(32-22(18)33)34-14-16(13-30-34)24(35)36/h13-15,17,19-20,23H,12H2,1-11H3,(H,35,36)(H2,28,31,32)/t17-,19-,20-,23?/m1/s1 |
| InChIKey | FGNZOVAJPFQKCJ-PSBUXNCMSA-N |
| XLogP | 5.38 |
| TPSA | 152.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.87 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|