C40H62N2O7 — CID 58310996
(3S,13R,16S,17R,19S)-3-[(4S)-5,5-dimethyl-2-oxo-4-[(2-oxopiperidin-1-yl)methyl]hexyl]-18,18-dimethyl-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione (PubChem CID 58310996) has the molecular formula C40H62N2O7 and a molecular weight of 682.94 g/mol. Its IUPAC name is (3S,13R,16S,17R,19S)-3-[(4S)-5,5-dimethyl-2-oxo-4-[(2-oxopiperidin-1-yl)methyl]hexyl]-18,18-dimethyl-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione.
| Compound Name | (3S,13R,16S,17R,19S)-3-[(4S)-5,5-dimethyl-2-oxo-4-[(2-oxopiperidin-1-yl)methyl]hexyl]-18,18-dimethyl-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione |
|---|---|
| PubChem CID | 58310996 |
| Molecular Formula | C40H62N2O7 |
| Molecular Weight | 682.94 g/mol |
| Exact Mass | 682.46 |
| IUPAC Name | (3S,13R,16S,17R,19S)-3-[(4S)-5,5-dimethyl-2-oxo-4-[(2-oxopiperidin-1-yl)methyl]hexyl]-18,18-dimethyl-13-(2-oxohex-5-enoyl)-5-oxa-1-azatricyclo[14.4.0.017,19]icosane-2,15-dione |
| SMILES | C=CCCC(=O)C(=O)[C@@H]1CCCCCCCOC[C@H](CC(=O)C[C@H](CN2CCCCC2=O)C(C)(C)C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)C1)C3(C)C |
| InChI | InChI=1S/C40H62N2O7/c1-7-8-17-32(44)37(47)27-16-12-10-9-11-15-20-49-26-28(38(48)42-25-31-35(40(31,5)6)36(42)33(45)22-27)21-30(43)23-29(39(2,3)4)24-41-19-14-13-18-34(41)46/h7,27-29,31,35-36H,1,8-26H2,2-6H3/t27-,28+,29-,31+,35+,36-/m1/s1 |
| InChIKey | KEVIDBJRGHMUAE-SDVAFVKWSA-N |
| XLogP | 6.16 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.94 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|