C33H49NO7 — CID 58311112
tert-butyl 2-[(3R,13R,16S,17R,19S)-18,18-dimethyl-2,6,15-trioxo-13-(2-oxohex-5-enoyl)-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate (PubChem CID 58311112) has the molecular formula C33H49NO7 and a molecular weight of 571.76 g/mol. Its IUPAC name is tert-butyl 2-[(3R,13R,16S,17R,19S)-18,18-dimethyl-2,6,15-trioxo-13-(2-oxohex-5-enoyl)-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,13R,16S,17R,19S)-18,18-dimethyl-2,6,15-trioxo-13-(2-oxohex-5-enoyl)-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate |
|---|---|
| PubChem CID | 58311112 |
| Molecular Formula | C33H49NO7 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.35 |
| IUPAC Name | tert-butyl 2-[(3R,13R,16S,17R,19S)-18,18-dimethyl-2,6,15-trioxo-13-(2-oxohex-5-enoyl)-1-azatricyclo[14.4.0.017,19]icosan-3-yl]acetate |
| SMILES | C=CCCC(=O)C(=O)[C@@H]1CCCCCCC(=O)CC[C@H](CC(=O)OC(C)(C)C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)C1)C3(C)C |
| InChI | InChI=1S/C33H49NO7/c1-7-8-15-25(36)30(39)21-13-11-9-10-12-14-23(35)17-16-22(19-27(38)41-32(2,3)4)31(40)34-20-24-28(33(24,5)6)29(34)26(37)18-21/h7,21-22,24,28-29H,1,8-20H2,2-6H3/t21-,22-,24+,28+,29-/m1/s1 |
| InChIKey | ICJZWOBWRLDLNI-MWBZIFCFSA-N |
| XLogP | 5.20 |
| TPSA | 114.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|