C31H47NO6 — CID 58263059
tert-butyl (3S)-4-[(2S)-2-(3-but-3-enyl-4,5-dioxonon-8-enoyl)pyrrolidin-1-yl]-3-cyclohexyl-4-oxobutanoate (PubChem CID 58263059) has the molecular formula C31H47NO6 and a molecular weight of 529.72 g/mol. Its IUPAC name is tert-butyl (3S)-4-[(2S)-2-(3-but-3-enyl-4,5-dioxonon-8-enoyl)pyrrolidin-1-yl]-3-cyclohexyl-4-oxobutanoate.
| Compound Name | tert-butyl (3S)-4-[(2S)-2-(3-but-3-enyl-4,5-dioxonon-8-enoyl)pyrrolidin-1-yl]-3-cyclohexyl-4-oxobutanoate |
|---|---|
| PubChem CID | 58263059 |
| Molecular Formula | C31H47NO6 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | tert-butyl (3S)-4-[(2S)-2-(3-but-3-enyl-4,5-dioxonon-8-enoyl)pyrrolidin-1-yl]-3-cyclohexyl-4-oxobutanoate |
| SMILES | C=CCCC(=O)C(=O)C(CCC=C)CC(=O)[C@@H]1CCCN1C(=O)[C@@H](CC(=O)OC(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C31H47NO6/c1-6-8-14-23(29(36)26(33)18-9-7-2)20-27(34)25-17-13-19-32(25)30(37)24(22-15-11-10-12-16-22)21-28(35)38-31(3,4)5/h6-7,22-25H,1-2,8-21H2,3-5H3/t23?,24-,25-/m0/s1 |
| InChIKey | UTHBGDCACFQAJY-DJHGOXGWSA-N |
| XLogP | 5.55 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|