C34H55NO6 — CID 160992388
tert-butyl (3S)-4-[(2S)-2-(3-but-3-enyl-4,5-dioxonon-8-enoyl)pyrrolidin-1-yl]-3-cyclohexyl-4-oxobutanoate;propane (PubChem CID 160992388) has the molecular formula C34H55NO6 and a molecular weight of 573.82 g/mol. Its IUPAC name is tert-butyl (3S)-4-[(2S)-2-(3-but-3-enyl-4,5-dioxonon-8-enoyl)pyrrolidin-1-yl]-3-cyclohexyl-4-oxobutanoate;propane.
| Compound Name | tert-butyl (3S)-4-[(2S)-2-(3-but-3-enyl-4,5-dioxonon-8-enoyl)pyrrolidin-1-yl]-3-cyclohexyl-4-oxobutanoate;propane |
|---|---|
| PubChem CID | 160992388 |
| Molecular Formula | C34H55NO6 |
| Molecular Weight | 573.82 g/mol |
| Exact Mass | 573.40 |
| IUPAC Name | tert-butyl (3S)-4-[(2S)-2-(3-but-3-enyl-4,5-dioxonon-8-enoyl)pyrrolidin-1-yl]-3-cyclohexyl-4-oxobutanoate;propane |
| SMILES | C=CCCC(=O)C(=O)C(CCC=C)CC(=O)[C@@H]1CCCN1C(=O)[C@@H](CC(=O)OC(C)(C)C)C1CCCCC1.CCC |
| InChI | InChI=1S/C31H47NO6.C3H8/c1-6-8-14-23(29(36)26(33)18-9-7-2)20-27(34)25-17-13-19-32(25)30(37)24(22-15-11-10-12-16-22)21-28(35)38-31(3,4)5;1-3-2/h6-7,22-25H,1-2,8-21H2,3-5H3;3H2,1-2H3/t23?,24-,25-;/m0./s1 |
| InChIKey | TUUNSNDVWNKCDB-ZUGXQZKVSA-N |
| XLogP | 6.97 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.82 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|