C25H24F3N5O3S — CID 58311663
(5Z)-2-[(3R)-3-(hydroxymethyl)piperazin-1-yl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 58311663) has the molecular formula C25H24F3N5O3S and a molecular weight of 531.56 g/mol. Its IUPAC name is (5Z)-2-[(3R)-3-(hydroxymethyl)piperazin-1-yl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-[(3R)-3-(hydroxymethyl)piperazin-1-yl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58311663 |
| Molecular Formula | C25H24F3N5O3S |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | (5Z)-2-[(3R)-3-(hydroxymethyl)piperazin-1-yl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | COc1ccc(Cn2ncc3cc(/C=C4\SC(N5CCN[C@@H](CO)C5)=NC4=O)ccc32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F3N5O3S/c1-36-19-4-3-16(20(10-19)25(26,27)28)12-33-21-5-2-15(8-17(21)11-30-33)9-22-23(35)31-24(37-22)32-7-6-29-18(13-32)14-34/h2-5,8-11,18,29,34H,6-7,12-14H2,1H3/b22-9-/t18-/m1/s1 |
| InChIKey | RLIAMGOHWBFMPW-XTZWOAOXSA-N |
| XLogP | 3.35 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|