C24H22F3N5O2S — CID 58311673
(5Z)-5-[[1-[[4-hydroxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one (PubChem CID 58311673) has the molecular formula C24H22F3N5O2S and a molecular weight of 501.53 g/mol. Its IUPAC name is (5Z)-5-[[1-[[4-hydroxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[1-[[4-hydroxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58311673 |
| Molecular Formula | C24H22F3N5O2S |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | (5Z)-5-[[1-[[4-hydroxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-2-(4-methylpiperazin-1-yl)-1,3-thiazol-4-one |
| SMILES | CN1CCN(C2=NC(=O)/C(=C/c3ccc4c(cnn4Cc4ccc(O)cc4C(F)(F)F)c3)S2)CC1 |
| InChI | InChI=1S/C24H22F3N5O2S/c1-30-6-8-31(9-7-30)23-29-22(34)21(35-23)11-15-2-5-20-17(10-15)13-28-32(20)14-16-3-4-18(33)12-19(16)24(25,26)27/h2-5,10-13,33H,6-9,14H2,1H3/b21-11- |
| InChIKey | VJIMZOITFKIMAY-NHDPSOOVSA-N |
| XLogP | 4.03 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|