C25H24F3N5O4S2 — CID 58311696
[4-[[5-[(Z)-[2-(4-methylpiperazin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]indazol-1-yl]methyl]-3-(trifluoromethyl)phenyl] methanesulfonate (PubChem CID 58311696) has the molecular formula C25H24F3N5O4S2 and a molecular weight of 579.63 g/mol. Its IUPAC name is [4-[[5-[(Z)-[2-(4-methylpiperazin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]indazol-1-yl]methyl]-3-(trifluoromethyl)phenyl] methanesulfonate.
| Compound Name | [4-[[5-[(Z)-[2-(4-methylpiperazin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]indazol-1-yl]methyl]-3-(trifluoromethyl)phenyl] methanesulfonate |
|---|---|
| PubChem CID | 58311696 |
| Molecular Formula | C25H24F3N5O4S2 |
| Molecular Weight | 579.63 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | [4-[[5-[(Z)-[2-(4-methylpiperazin-1-yl)-4-oxo-1,3-thiazol-5-ylidene]methyl]indazol-1-yl]methyl]-3-(trifluoromethyl)phenyl] methanesulfonate |
| SMILES | CN1CCN(C2=NC(=O)/C(=C/c3ccc4c(cnn4Cc4ccc(OS(C)(=O)=O)cc4C(F)(F)F)c3)S2)CC1 |
| InChI | InChI=1S/C25H24F3N5O4S2/c1-31-7-9-32(10-8-31)24-30-23(34)22(38-24)12-16-3-6-21-18(11-16)14-29-33(21)15-17-4-5-19(37-39(2,35)36)13-20(17)25(26,27)28/h3-6,11-14H,7-10,15H2,1-2H3/b22-12- |
| InChIKey | YNHCIIGATHZOFQ-UUYOSTAYSA-N |
| XLogP | 3.66 |
| TPSA | 97.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.63 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|