C24H21F3N4O4S — CID 58311760
(5Z)-2-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one (PubChem CID 58311760) has the molecular formula C24H21F3N4O4S and a molecular weight of 518.52 g/mol. Its IUPAC name is (5Z)-2-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 58311760 |
| Molecular Formula | C24H21F3N4O4S |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | (5Z)-2-[(3R,4R)-3,4-dihydroxypyrrolidin-1-yl]-5-[[1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]indazol-5-yl]methylidene]-1,3-thiazol-4-one |
| SMILES | COc1ccc(Cn2ncc3cc(/C=C4\SC(N5C[C@@H](O)[C@H](O)C5)=NC4=O)ccc32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H21F3N4O4S/c1-35-16-4-3-14(17(8-16)24(25,26)27)10-31-18-5-2-13(6-15(18)9-28-31)7-21-22(34)29-23(36-21)30-11-19(32)20(33)12-30/h2-9,19-20,32-33H,10-12H2,1H3/b21-7-/t19-,20-/m1/s1 |
| InChIKey | GIUUEDBMOSMTID-HXXKXOTHSA-N |
| XLogP | 3.12 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|