C8H10F8NO4S2- — CID 58312162
bis(1,1,3,3-tetrafluorobutylsulfonyl)azanide (PubChem CID 58312162) has the molecular formula C8H10F8NO4S2- and a molecular weight of 400.29 g/mol. Its IUPAC name is bis(1,1,3,3-tetrafluorobutylsulfonyl)azanide.
| Compound Name | bis(1,1,3,3-tetrafluorobutylsulfonyl)azanide |
|---|---|
| PubChem CID | 58312162 |
| Molecular Formula | C8H10F8NO4S2- |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | bis(1,1,3,3-tetrafluorobutylsulfonyl)azanide |
| SMILES | CC(F)(F)CC(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)CC(C)(F)F |
| InChI | InChI=1S/C8H10F8NO4S2/c1-5(9,10)3-7(13,14)22(18,19)17-23(20,21)8(15,16)4-6(2,11)12/h3-4H2,1-2H3/q-1 |
| InChIKey | WORMYWFOAMGWDJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |