C10H18F6N3O6S4- — CID 20750473
bis[S-butyl-N-(trifluoromethylsulfonyl)sulfonimidoyl]azanide (PubChem CID 20750473) has the molecular formula C10H18F6N3O6S4- and a molecular weight of 518.53 g/mol. Its IUPAC name is bis[S-butyl-N-(trifluoromethylsulfonyl)sulfonimidoyl]azanide.
| Compound Name | bis[S-butyl-N-(trifluoromethylsulfonyl)sulfonimidoyl]azanide |
|---|---|
| PubChem CID | 20750473 |
| Molecular Formula | C10H18F6N3O6S4- |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.00 |
| IUPAC Name | bis[S-butyl-N-(trifluoromethylsulfonyl)sulfonimidoyl]azanide |
| SMILES | CCCCS(=O)(=NS(=O)(=O)C(F)(F)F)[N-]S(=O)(CCCC)=NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H18F6N3O6S4/c1-3-5-7-26(20,18-28(22,23)9(11,12)13)17-27(21,8-6-4-2)19-29(24,25)10(14,15)16/h3-8H2,1-2H3/q-1 |
| InChIKey | DFPNWQMFLDMMAM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 141.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |