C18H34F6N3O6S4- — CID 59106093
bis[S-octyl-N-(trifluoromethylsulfonyl)sulfonimidoyl]azanide (PubChem CID 59106093) has the molecular formula C18H34F6N3O6S4- and a molecular weight of 630.74 g/mol. Its IUPAC name is bis[S-octyl-N-(trifluoromethylsulfonyl)sulfonimidoyl]azanide.
| Compound Name | bis[S-octyl-N-(trifluoromethylsulfonyl)sulfonimidoyl]azanide |
|---|---|
| PubChem CID | 59106093 |
| Molecular Formula | C18H34F6N3O6S4- |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.12 |
| IUPAC Name | bis[S-octyl-N-(trifluoromethylsulfonyl)sulfonimidoyl]azanide |
| SMILES | CCCCCCCCS(=O)(=NS(=O)(=O)C(F)(F)F)[N-]S(=O)(CCCCCCCC)=NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H34F6N3O6S4/c1-3-5-7-9-11-13-15-34(28,26-36(30,31)17(19,20)21)25-35(29,16-14-12-10-8-6-4-2)27-37(32,33)18(22,23)24/h3-16H2,1-2H3/q-1 |
| InChIKey | WTNJFNQIETYBRB-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 141.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|