C20H16F3N7O3 — CID 58313912
(3E)-3-[[4-(cyclopropylamino)-2-[3-(trifluoromethoxy)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58313912) has the molecular formula C20H16F3N7O3 and a molecular weight of 459.39 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[3-(trifluoromethoxy)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[3-(trifluoromethoxy)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58313912 |
| Molecular Formula | C20H16F3N7O3 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[3-(trifluoromethoxy)anilino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(Nc4cccc(OC(F)(F)F)c4)nc23)C(=O)N1 |
| InChI | InChI=1S/C20H16F3N7O3/c21-20(22,23)33-14-3-1-2-13(8-14)25-18-28-16-11(6-10-7-15(31)27-17(10)32)9-24-30(16)19(29-18)26-12-4-5-12/h1-3,6,8-9,12H,4-5,7H2,(H,27,31,32)(H2,25,26,28,29)/b10-6+ |
| InChIKey | QISCBKBAOLPBBE-UXBLZVDNSA-N |
| XLogP | 2.77 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|