C17H19N7O3 — CID 58313923
(3E)-3-[[4-(cyclopropylamino)-2-[(3S)-3-hydroxypyrrolidin-1-yl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58313923) has the molecular formula C17H19N7O3 and a molecular weight of 369.39 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[(3S)-3-hydroxypyrrolidin-1-yl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[(3S)-3-hydroxypyrrolidin-1-yl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58313923 |
| Molecular Formula | C17H19N7O3 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[(3S)-3-hydroxypyrrolidin-1-yl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(N4CC[C@H](O)C4)nc23)C(=O)N1 |
| InChI | InChI=1S/C17H19N7O3/c25-12-3-4-23(8-12)16-21-14-10(5-9-6-13(26)20-15(9)27)7-18-24(14)17(22-16)19-11-1-2-11/h5,7,11-12,25H,1-4,6,8H2,(H,19,21,22)(H,20,26,27)/b9-5+/t12-/m0/s1 |
| InChIKey | ZZKLBYWJXHUYAH-LHXVZLOVSA-N |
| XLogP | -0.30 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|