C17H19N7O2 — CID 58315131
(3E)-3-[[4-(cyclopropylamino)-2-pyrrolidin-1-ylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58315131) has the molecular formula C17H19N7O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-pyrrolidin-1-ylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-pyrrolidin-1-ylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58315131 |
| Molecular Formula | C17H19N7O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-pyrrolidin-1-ylpyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(N4CCCC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C17H19N7O2/c25-13-8-10(15(26)20-13)7-11-9-18-24-14(11)21-16(23-5-1-2-6-23)22-17(24)19-12-3-4-12/h7,9,12H,1-6,8H2,(H,19,21,22)(H,20,25,26)/b10-7+ |
| InChIKey | LIKYBKZVNICSRG-JXMROGBWSA-N |
| XLogP | 0.73 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|