C23H22F3N9O2 — CID 58315160
(3E)-3-[[4-(cyclopropylamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58315160) has the molecular formula C23H22F3N9O2 and a molecular weight of 513.48 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58315160 |
| Molecular Formula | C23H22F3N9O2 |
| Molecular Weight | 513.48 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(N4CCN(c5ccc(C(F)(F)F)cn5)CC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C23H22F3N9O2/c24-23(25,26)15-1-4-17(27-12-15)33-5-7-34(8-6-33)21-31-19-14(9-13-10-18(36)30-20(13)37)11-28-35(19)22(32-21)29-16-2-3-16/h1,4,9,11-12,16H,2-3,5-8,10H2,(H,29,31,32)(H,30,36,37)/b13-9+ |
| InChIKey | FZGHDGSQZGEQIF-UKTHLTGXSA-N |
| XLogP | 1.87 |
| TPSA | 120.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|