C20H15ClF3N7O2 — CID 58315092
(3E)-3-[[2-[4-chloro-3-(trifluoromethyl)anilino]-4-(cyclopropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58315092) has the molecular formula C20H15ClF3N7O2 and a molecular weight of 477.83 g/mol. Its IUPAC name is (3E)-3-[[2-[4-chloro-3-(trifluoromethyl)anilino]-4-(cyclopropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[2-[4-chloro-3-(trifluoromethyl)anilino]-4-(cyclopropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58315092 |
| Molecular Formula | C20H15ClF3N7O2 |
| Molecular Weight | 477.83 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | (3E)-3-[[2-[4-chloro-3-(trifluoromethyl)anilino]-4-(cyclopropylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(Nc4ccc(Cl)c(C(F)(F)F)c4)nc23)C(=O)N1 |
| InChI | InChI=1S/C20H15ClF3N7O2/c21-14-4-3-12(7-13(14)20(22,23)24)26-18-29-16-10(5-9-6-15(32)28-17(9)33)8-25-31(16)19(30-18)27-11-1-2-11/h3-5,7-8,11H,1-2,6H2,(H,28,32,33)(H2,26,27,29,30)/b9-5+ |
| InChIKey | WMJBFDOLJNLGBR-WEVVVXLNSA-N |
| XLogP | 3.54 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.83 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|