C21H21N7O3 — CID 76721969
3-[[4-anilino-2-(1,4-oxazepan-4-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 76721969) has the molecular formula C21H21N7O3 and a molecular weight of 419.45 g/mol. Its IUPAC name is 3-[[4-anilino-2-(1,4-oxazepan-4-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-[[4-anilino-2-(1,4-oxazepan-4-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 76721969 |
| Molecular Formula | C21H21N7O3 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 3-[[4-anilino-2-(1,4-oxazepan-4-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(=Cc2cnn3c(Nc4ccccc4)nc(N4CCCOCC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C21H21N7O3/c29-17-12-14(19(30)24-17)11-15-13-22-28-18(15)25-20(27-7-4-9-31-10-8-27)26-21(28)23-16-5-2-1-3-6-16/h1-3,5-6,11,13H,4,7-10,12H2,(H,23,25,26)(H,24,29,30) |
| InChIKey | LLPUTFMYSHJOMY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 113.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|