C17H19N7O4S — CID 58314104
(3E)-3-[[4-(cyclopropylamino)-2-(1,1-dioxo-1,4-thiazinan-4-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314104) has the molecular formula C17H19N7O4S and a molecular weight of 417.45 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-(1,1-dioxo-1,4-thiazinan-4-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-(1,1-dioxo-1,4-thiazinan-4-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314104 |
| Molecular Formula | C17H19N7O4S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-(1,1-dioxo-1,4-thiazinan-4-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(N4CCS(=O)(=O)CC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C17H19N7O4S/c25-13-8-10(15(26)20-13)7-11-9-18-24-14(11)21-16(22-17(24)19-12-1-2-12)23-3-5-29(27,28)6-4-23/h7,9,12H,1-6,8H2,(H,19,21,22)(H,20,25,26)/b10-7+ |
| InChIKey | SZZZMFMDSYBCPG-JXMROGBWSA-N |
| XLogP | -0.64 |
| TPSA | 138.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|