C24H24ClN7O4 — CID 58314203
methyl 4-[[5-(3-chloroanilino)-3-[(E)-(2,5-dioxopyrrolidin-3-ylidene)methyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]piperidine-1-carboxylate (PubChem CID 58314203) has the molecular formula C24H24ClN7O4 and a molecular weight of 509.95 g/mol. Its IUPAC name is methyl 4-[[5-(3-chloroanilino)-3-[(E)-(2,5-dioxopyrrolidin-3-ylidene)methyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]piperidine-1-carboxylate.
| Compound Name | methyl 4-[[5-(3-chloroanilino)-3-[(E)-(2,5-dioxopyrrolidin-3-ylidene)methyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58314203 |
| Molecular Formula | C24H24ClN7O4 |
| Molecular Weight | 509.95 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | methyl 4-[[5-(3-chloroanilino)-3-[(E)-(2,5-dioxopyrrolidin-3-ylidene)methyl]pyrazolo[1,5-a]pyrimidin-7-yl]amino]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(Nc2cc(Nc3cccc(Cl)c3)nc3c(/C=C4\CC(=O)NC4=O)cnn23)CC1 |
| InChI | InChI=1S/C24H24ClN7O4/c1-36-24(35)31-7-5-17(6-8-31)28-20-12-19(27-18-4-2-3-16(25)11-18)29-22-15(13-26-32(20)22)9-14-10-21(33)30-23(14)34/h2-4,9,11-13,17,28H,5-8,10H2,1H3,(H,27,29)(H,30,33,34)/b14-9+ |
| InChIKey | YOYAZORJQNXRTM-NTEUORMPSA-N |
| XLogP | 3.20 |
| TPSA | 129.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.95 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|