C20H17FN6O3 — CID 58314391
(3E)-3-[[4-(cyclopropylamino)-2-(4-fluoro-2-methylphenoxy)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314391) has the molecular formula C20H17FN6O3 and a molecular weight of 408.39 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-(4-fluoro-2-methylphenoxy)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-(4-fluoro-2-methylphenoxy)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314391 |
| Molecular Formula | C20H17FN6O3 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-(4-fluoro-2-methylphenoxy)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | Cc1cc(F)ccc1Oc1nc(NC2CC2)n2ncc(/C=C3\CC(=O)NC3=O)c2n1 |
| InChI | InChI=1S/C20H17FN6O3/c1-10-6-13(21)2-5-15(10)30-20-25-17-12(7-11-8-16(28)24-18(11)29)9-22-27(17)19(26-20)23-14-3-4-14/h2,5-7,9,14H,3-4,8H2,1H3,(H,23,25,26)(H,24,28,29)/b11-7+ |
| InChIKey | YXQZPSIENAVEKM-YRNVUSSQSA-N |
| XLogP | 2.37 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|