C19H15FN6O3 — CID 58313891
(3E)-3-[[4-(cyclopropylamino)-2-(3-fluorophenoxy)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58313891) has the molecular formula C19H15FN6O3 and a molecular weight of 394.37 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-(3-fluorophenoxy)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-(3-fluorophenoxy)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58313891 |
| Molecular Formula | C19H15FN6O3 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-(3-fluorophenoxy)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NC4CC4)nc(Oc4cccc(F)c4)nc23)C(=O)N1 |
| InChI | InChI=1S/C19H15FN6O3/c20-12-2-1-3-14(8-12)29-19-24-16-11(6-10-7-15(27)23-17(10)28)9-21-26(16)18(25-19)22-13-4-5-13/h1-3,6,8-9,13H,4-5,7H2,(H,22,24,25)(H,23,27,28)/b10-6+ |
| InChIKey | YMJGWNJQAZZFNV-UXBLZVDNSA-N |
| XLogP | 2.06 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|