C24H25F3N8O4 — CID 58314417
(3E)-3-[[2-[3-(2-morpholin-4-ylethoxy)anilino]-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314417) has the molecular formula C24H25F3N8O4 and a molecular weight of 546.51 g/mol. Its IUPAC name is (3E)-3-[[2-[3-(2-morpholin-4-ylethoxy)anilino]-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[2-[3-(2-morpholin-4-ylethoxy)anilino]-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314417 |
| Molecular Formula | C24H25F3N8O4 |
| Molecular Weight | 546.51 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | (3E)-3-[[2-[3-(2-morpholin-4-ylethoxy)anilino]-4-(2,2,2-trifluoroethylamino)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1C/C(=C\c2cnn3c(NCC(F)(F)F)nc(Nc4cccc(OCCN5CCOCC5)c4)nc23)C(=O)N1 |
| InChI | InChI=1S/C24H25F3N8O4/c25-24(26,27)14-28-23-33-22(32-20-16(13-29-35(20)23)10-15-11-19(36)31-21(15)37)30-17-2-1-3-18(12-17)39-9-6-34-4-7-38-8-5-34/h1-3,10,12-13H,4-9,11,14H2,(H,31,36,37)(H2,28,30,32,33)/b15-10+ |
| InChIKey | WKODKYRAZWQQRD-XNTDXEJSSA-N |
| XLogP | 1.98 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|