C19H24N8O4S — CID 58314745
(3E)-3-[[4-(cyclopropylamino)-2-(4-ethylsulfonylpiperazin-1-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58314745) has the molecular formula C19H24N8O4S and a molecular weight of 460.52 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-(4-ethylsulfonylpiperazin-1-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-(4-ethylsulfonylpiperazin-1-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58314745 |
| Molecular Formula | C19H24N8O4S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-(4-ethylsulfonylpiperazin-1-yl)pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CCS(=O)(=O)N1CCN(c2nc(NC3CC3)n3ncc(/C=C4\CC(=O)NC4=O)c3n2)CC1 |
| InChI | InChI=1S/C19H24N8O4S/c1-2-32(30,31)26-7-5-25(6-8-26)18-23-16-13(9-12-10-15(28)22-17(12)29)11-20-27(16)19(24-18)21-14-3-4-14/h9,11,14H,2-8,10H2,1H3,(H,21,23,24)(H,22,28,29)/b12-9+ |
| InChIKey | HJPPOLADJFOLKN-FMIVXFBMSA-N |
| XLogP | -0.40 |
| TPSA | 141.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|