C22H20N8O3 — CID 58315086
(3E)-3-[[4-(cyclopropylamino)-2-[(1-methyl-2-oxo-3H-indol-3-yl)amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 58315086) has the molecular formula C22H20N8O3 and a molecular weight of 444.46 g/mol. Its IUPAC name is (3E)-3-[[4-(cyclopropylamino)-2-[(1-methyl-2-oxo-3H-indol-3-yl)amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | (3E)-3-[[4-(cyclopropylamino)-2-[(1-methyl-2-oxo-3H-indol-3-yl)amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58315086 |
| Molecular Formula | C22H20N8O3 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (3E)-3-[[4-(cyclopropylamino)-2-[(1-methyl-2-oxo-3H-indol-3-yl)amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | CN1C(=O)C(Nc2nc(NC3CC3)n3ncc(/C=C4\CC(=O)NC4=O)c3n2)c2ccccc21 |
| InChI | InChI=1S/C22H20N8O3/c1-29-15-5-3-2-4-14(15)17(20(29)33)26-21-27-18-12(8-11-9-16(31)25-19(11)32)10-23-30(18)22(28-21)24-13-6-7-13/h2-5,8,10,13,17H,6-7,9H2,1H3,(H,25,31,32)(H2,24,26,27,28)/b11-8+ |
| InChIKey | SYXAWLOIURHTJF-DHZHZOJOSA-N |
| XLogP | 1.26 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|