C29H39BN2O6 — CID 58315884
methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]acetyl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 58315884) has the molecular formula C29H39BN2O6 and a molecular weight of 522.45 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]acetyl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]acetyl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 58315884 |
| Molecular Formula | C29H39BN2O6 |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-oxo-1-[(2S)-2-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]acetyl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Cc1ccc2cc(B3OC(C)(C)C(C)(C)O3)ccc2c1)C(C)C |
| InChI | InChI=1S/C29H39BN2O6/c1-18(2)25(31-27(35)36-7)26(34)32-14-8-9-23(32)24(33)16-19-10-11-21-17-22(13-12-20(21)15-19)30-37-28(3,4)29(5,6)38-30/h10-13,15,17-18,23,25H,8-9,14,16H2,1-7H3,(H,31,35)/t23-,25-/m0/s1 |
| InChIKey | VRPUHUCTCDEFBV-ZCYQVOJMSA-N |
| XLogP | 3.62 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|