C17H21NO5 — CID 58317010
4-(3-cyclohexyloxypropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58317010) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-(3-cyclohexyloxypropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-(3-cyclohexyloxypropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58317010 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 4-(3-cyclohexyloxypropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | O=C1Cc2oc(=O)cc(CCCOC3CCCCC3)c2C(=O)N1 |
| InChI | InChI=1S/C17H21NO5/c19-14-10-13-16(17(21)18-14)11(9-15(20)23-13)5-4-8-22-12-6-2-1-3-7-12/h9,12H,1-8,10H2,(H,18,19,21) |
| InChIKey | XITOOFARVCNFRK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|