C10H6F3NO4 — CID 58317097
4-(2,2,2-trifluoroethyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58317097) has the molecular formula C10H6F3NO4 and a molecular weight of 261.15 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-(2,2,2-trifluoroethyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58317097 |
| Molecular Formula | C10H6F3NO4 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 4-(2,2,2-trifluoroethyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | O=C1Cc2oc(=O)cc(CC(F)(F)F)c2C(=O)N1 |
| InChI | InChI=1S/C10H6F3NO4/c11-10(12,13)3-4-1-7(16)18-5-2-6(15)14-9(17)8(4)5/h1H,2-3H2,(H,14,15,17) |
| InChIKey | ZBWADUPHMLXBDD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|