C12H11F2NO4 — CID 58317114
4-(4,4-difluorobutyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58317114) has the molecular formula C12H11F2NO4 and a molecular weight of 271.22 g/mol. Its IUPAC name is 4-(4,4-difluorobutyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-(4,4-difluorobutyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58317114 |
| Molecular Formula | C12H11F2NO4 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 4-(4,4-difluorobutyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | O=C1Cc2oc(=O)cc(CCCC(F)F)c2C(=O)N1 |
| InChI | InChI=1S/C12H11F2NO4/c13-8(14)3-1-2-6-4-10(17)19-7-5-9(16)15-12(18)11(6)7/h4,8H,1-3,5H2,(H,15,16,18) |
| InChIKey | DGISUGDNGUQODP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|