C11H9F2NO4 — CID 58317125
4-(3,3-difluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58317125) has the molecular formula C11H9F2NO4 and a molecular weight of 257.19 g/mol. Its IUPAC name is 4-(3,3-difluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-(3,3-difluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58317125 |
| Molecular Formula | C11H9F2NO4 |
| Molecular Weight | 257.19 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 4-(3,3-difluoropropyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | O=C1Cc2oc(=O)cc(CCC(F)F)c2C(=O)N1 |
| InChI | InChI=1S/C11H9F2NO4/c12-7(13)2-1-5-3-9(16)18-6-4-8(15)14-11(17)10(5)6/h3,7H,1-2,4H2,(H,14,15,17) |
| InChIKey | FWGHRLXAOGQDIF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|