C19H18N2O5 — CID 58317165
1,5-diethyl-3-phenacylpyrano[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 58317165) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is 1,5-diethyl-3-phenacylpyrano[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 1,5-diethyl-3-phenacylpyrano[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 58317165 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1,5-diethyl-3-phenacylpyrano[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | CCc1cc(=O)oc2c1c(=O)n(CC(=O)c1ccccc1)c(=O)n2CC |
| InChI | InChI=1S/C19H18N2O5/c1-3-12-10-15(23)26-18-16(12)17(24)21(19(25)20(18)4-2)11-14(22)13-8-6-5-7-9-13/h5-10H,3-4,11H2,1-2H3 |
| InChIKey | YLIIZGRTPMLVSQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 91.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |