C19H14N2O5 — CID 58317217
4-[2-(4-ethyl-2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-6-yl)acetyl]benzonitrile (PubChem CID 58317217) has the molecular formula C19H14N2O5 and a molecular weight of 350.33 g/mol. Its IUPAC name is 4-[2-(4-ethyl-2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-6-yl)acetyl]benzonitrile.
| Compound Name | 4-[2-(4-ethyl-2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-6-yl)acetyl]benzonitrile |
|---|---|
| PubChem CID | 58317217 |
| Molecular Formula | C19H14N2O5 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 4-[2-(4-ethyl-2,5,7-trioxo-8H-pyrano[3,2-c]pyridin-6-yl)acetyl]benzonitrile |
| SMILES | CCc1cc(=O)oc2c1C(=O)N(CC(=O)c1ccc(C#N)cc1)C(=O)C2 |
| InChI | InChI=1S/C19H14N2O5/c1-2-12-7-17(24)26-15-8-16(23)21(19(25)18(12)15)10-14(22)13-5-3-11(9-20)4-6-13/h3-7H,2,8,10H2,1H3 |
| InChIKey | KHSCWVJRMCHFLH-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 108.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|