C18H15NO5 — CID 58317109
4-ethyl-6-phenacyl-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58317109) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-ethyl-6-phenacyl-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-ethyl-6-phenacyl-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58317109 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-ethyl-6-phenacyl-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | CCc1cc(=O)oc2c1C(=O)N(CC(=O)c1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C18H15NO5/c1-2-11-8-16(22)24-14-9-15(21)19(18(23)17(11)14)10-13(20)12-6-4-3-5-7-12/h3-8H,2,9-10H2,1H3 |
| InChIKey | ADXXLYBHVZMXMO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 84.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|