C24H25NO7S — CID 58318525
hydroxymethyl 2-[5-[2-[[2-(2,3,4-trimethoxyphenyl)acetyl]amino]phenyl]thiophen-2-yl]acetate (PubChem CID 58318525) has the molecular formula C24H25NO7S and a molecular weight of 471.53 g/mol. Its IUPAC name is hydroxymethyl 2-[5-[2-[[2-(2,3,4-trimethoxyphenyl)acetyl]amino]phenyl]thiophen-2-yl]acetate.
| Compound Name | hydroxymethyl 2-[5-[2-[[2-(2,3,4-trimethoxyphenyl)acetyl]amino]phenyl]thiophen-2-yl]acetate |
|---|---|
| PubChem CID | 58318525 |
| Molecular Formula | C24H25NO7S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | hydroxymethyl 2-[5-[2-[[2-(2,3,4-trimethoxyphenyl)acetyl]amino]phenyl]thiophen-2-yl]acetate |
| SMILES | COc1ccc(CC(=O)Nc2ccccc2-c2ccc(CC(=O)OCO)s2)c(OC)c1OC |
| InChI | InChI=1S/C24H25NO7S/c1-29-19-10-8-15(23(30-2)24(19)31-3)12-21(27)25-18-7-5-4-6-17(18)20-11-9-16(33-20)13-22(28)32-14-26/h4-11,26H,12-14H2,1-3H3,(H,25,27) |
| InChIKey | BWECZWYJLOXZNN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|