C28H24N2O7S — CID 88955601
3-nitro-N-[2-[5-(2-oxoethyl)thiophen-2-yl]phenyl]-5-(2,3,4-trimethoxyphenyl)benzamide (PubChem CID 88955601) has the molecular formula C28H24N2O7S and a molecular weight of 532.57 g/mol. Its IUPAC name is 3-nitro-N-[2-[5-(2-oxoethyl)thiophen-2-yl]phenyl]-5-(2,3,4-trimethoxyphenyl)benzamide.
| Compound Name | 3-nitro-N-[2-[5-(2-oxoethyl)thiophen-2-yl]phenyl]-5-(2,3,4-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 88955601 |
| Molecular Formula | C28H24N2O7S |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 3-nitro-N-[2-[5-(2-oxoethyl)thiophen-2-yl]phenyl]-5-(2,3,4-trimethoxyphenyl)benzamide |
| SMILES | COc1ccc(-c2cc(C(=O)Nc3ccccc3-c3ccc(CC=O)s3)cc([N+](=O)[O-])c2)c(OC)c1OC |
| InChI | InChI=1S/C28H24N2O7S/c1-35-24-10-9-21(26(36-2)27(24)37-3)17-14-18(16-19(15-17)30(33)34)28(32)29-23-7-5-4-6-22(23)25-11-8-20(38-25)12-13-31/h4-11,13-16H,12H2,1-3H3,(H,29,32) |
| InChIKey | XMBSKJQDECJQSR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|