C41H47N3O4S4 — CID 58321446
CID 58321446 (PubChem CID 58321446) has the molecular formula C41H47N3O4S4 and a molecular weight of 774.11 g/mol.
| Compound Name | CID 58321446 |
|---|---|
| PubChem CID | 58321446 |
| Molecular Formula | C41H47N3O4S4 |
| Molecular Weight | 774.11 g/mol |
| Exact Mass | 773.24 |
| IUPAC Name | — |
| SMILES | [CH]CCCCCCCCCSc1ccc(N2c3ccc(C=CC=c4s/c(=C5/SC(=S)N(CCC)C5=O)n(CC(=O)O)c4=O)cc3C3CCCC32)cc1 |
| InChI | InChI=1S/C41H47N3O4S4/c1-3-5-6-7-8-9-10-11-25-50-30-21-19-29(20-22-30)44-33-16-13-15-31(33)32-26-28(18-23-34(32)44)14-12-17-35-38(47)43(27-36(45)46)40(51-35)37-39(48)42(24-4-2)41(49)52-37/h1,12,14,17-23,26,31,33H,3-11,13,15-16,24-25,27H2,2H3,(H,45,46)/b14-12?,35-17?,40-37+ |
| InChIKey | VWHHEXDIEBFROO-MEKXREDXSA-N |
| XLogP | 8.58 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.11 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|