C31H36N2O3S3 — CID 58321554
2-[(5Z)-5-[[4-(4-octylsulfanylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 58321554) has the molecular formula C31H36N2O3S3 and a molecular weight of 580.84 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-(4-octylsulfanylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[4-(4-octylsulfanylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 58321554 |
| Molecular Formula | C31H36N2O3S3 |
| Molecular Weight | 580.84 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | 2-[(5Z)-5-[[4-(4-octylsulfanylphenyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCCCCCCCSc1ccc(N2c3ccc(/C=C4\SC(=S)N(CC(=O)O)C4=O)cc3C3CCCC32)cc1 |
| InChI | InChI=1S/C31H36N2O3S3/c1-2-3-4-5-6-7-17-38-23-14-12-22(13-15-23)33-26-10-8-9-24(26)25-18-21(11-16-27(25)33)19-28-30(36)32(20-29(34)35)31(37)39-28/h11-16,18-19,24,26H,2-10,17,20H2,1H3,(H,34,35)/b28-19- |
| InChIKey | FSBSDFSSOSADIE-USHMODERSA-N |
| XLogP | 8.21 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.84 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|