C27H35F3N2O5S — CID 58326270
N-ethyl-9-ethylsulfonyl-6-(oxan-4-yl)-N-(5,5,5-trifluoro-2-oxopentyl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide (PubChem CID 58326270) has the molecular formula C27H35F3N2O5S and a molecular weight of 556.65 g/mol. Its IUPAC name is N-ethyl-9-ethylsulfonyl-6-(oxan-4-yl)-N-(5,5,5-trifluoro-2-oxopentyl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide.
| Compound Name | N-ethyl-9-ethylsulfonyl-6-(oxan-4-yl)-N-(5,5,5-trifluoro-2-oxopentyl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
|---|---|
| PubChem CID | 58326270 |
| Molecular Formula | C27H35F3N2O5S |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | N-ethyl-9-ethylsulfonyl-6-(oxan-4-yl)-N-(5,5,5-trifluoro-2-oxopentyl)-5,6,7,8-tetrahydrocarbazole-3-carboxamide |
| SMILES | CCN(CC(=O)CCC(F)(F)F)C(=O)c1ccc2c(c1)c1c(n2S(=O)(=O)CC)CCC(C2CCOCC2)C1 |
| InChI | InChI=1S/C27H35F3N2O5S/c1-3-31(17-21(33)9-12-27(28,29)30)26(34)20-6-8-25-23(16-20)22-15-19(18-10-13-37-14-11-18)5-7-24(22)32(25)38(35,36)4-2/h6,8,16,18-19H,3-5,7,9-15,17H2,1-2H3 |
| InChIKey | QHJCYLRNVRJBOS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |