C6H4N4 — CID 583268
1-methylimidazole-4,5-dicarbonitrile (PubChem CID 583268) has the molecular formula C6H4N4 and a molecular weight of 132.13 g/mol. Its IUPAC name is 1-methylimidazole-4,5-dicarbonitrile.
| Compound Name | 1-methylimidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 583268 |
| Molecular Formula | C6H4N4 |
| Molecular Weight | 132.13 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | 1-methylimidazole-4,5-dicarbonitrile |
| SMILES | Cn1cnc(C#N)c1C#N |
| InChI | InChI=1S/C6H4N4/c1-10-4-9-5(2-7)6(10)3-8/h4H,1H3 |
| InChIKey | SUOVGHDPXJUFME-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 65.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.13 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |